C17H21F2N5O2S — CID 166928843
N'-[amino(2-cyanoethyl)amino]-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanimidamide (PubChem CID 166928843) has the molecular formula C17H21F2N5O2S and a molecular weight of 397.45 g/mol. Its IUPAC name is N'-[amino(2-cyanoethyl)amino]-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanimidamide.
| Compound Name | N'-[amino(2-cyanoethyl)amino]-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanimidamide |
|---|---|
| PubChem CID | 166928843 |
| Molecular Formula | C17H21F2N5O2S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N'-[amino(2-cyanoethyl)amino]-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanimidamide |
| SMILES | COc1cc2cc(C(F)(F)CC/C(N)=N/N(N)CCC#N)sc2cc1OC |
| InChI | InChI=1S/C17H21F2N5O2S/c1-25-12-8-11-9-15(27-14(11)10-13(12)26-2)17(18,19)5-4-16(21)23-24(22)7-3-6-20/h8-10H,3-5,7,22H2,1-2H3,(H2,21,23) |
| InChIKey | GBNFBLDTIGFGCL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|