C19H24F3NO4S — CID 164708071
4-[(3aE,6Z,9E)-4-fluoro-6,7-dimethoxy-5,8-dihydrocycloocta[b]thiophen-2-yl]-4,4-difluoro-N-hydroxy-N-propan-2-ylbutanamide (PubChem CID 164708071) has the molecular formula C19H24F3NO4S and a molecular weight of 419.47 g/mol. Its IUPAC name is 4-[(3aE,6Z,9E)-4-fluoro-6,7-dimethoxy-5,8-dihydrocycloocta[b]thiophen-2-yl]-4,4-difluoro-N-hydroxy-N-propan-2-ylbutanamide.
| Compound Name | 4-[(3aE,6Z,9E)-4-fluoro-6,7-dimethoxy-5,8-dihydrocycloocta[b]thiophen-2-yl]-4,4-difluoro-N-hydroxy-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 164708071 |
| Molecular Formula | C19H24F3NO4S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-[(3aE,6Z,9E)-4-fluoro-6,7-dimethoxy-5,8-dihydrocycloocta[b]thiophen-2-yl]-4,4-difluoro-N-hydroxy-N-propan-2-ylbutanamide |
| SMILES | CO/C1=C(\OC)C/C(F)=c2/cc(C(F)(F)CCC(=O)N(O)C(C)C)s/c2=C/C1 |
| InChI | InChI=1S/C19H24F3NO4S/c1-11(2)23(25)18(24)7-8-19(21,22)17-9-12-13(20)10-15(27-4)14(26-3)5-6-16(12)28-17/h6,9,11,25H,5,7-8,10H2,1-4H3/b13-12+,15-14-,16-6+ |
| InChIKey | MCXZKDOPTMDQEC-ZISBPYNMSA-N |
| XLogP | 3.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|