C19H23F3N2O5S — CID 154981017
4,4-difluoro-4-[8-fluoro-2-[2-(hydroxyamino)propyl]thieno[2,3-f][1,3]benzodioxol-6-yl]-N-hydroxy-N-propan-2-ylbutanamide (PubChem CID 154981017) has the molecular formula C19H23F3N2O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is 4,4-difluoro-4-[8-fluoro-2-[2-(hydroxyamino)propyl]thieno[2,3-f][1,3]benzodioxol-6-yl]-N-hydroxy-N-propan-2-ylbutanamide.
| Compound Name | 4,4-difluoro-4-[8-fluoro-2-[2-(hydroxyamino)propyl]thieno[2,3-f][1,3]benzodioxol-6-yl]-N-hydroxy-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 154981017 |
| Molecular Formula | C19H23F3N2O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 4,4-difluoro-4-[8-fluoro-2-[2-(hydroxyamino)propyl]thieno[2,3-f][1,3]benzodioxol-6-yl]-N-hydroxy-N-propan-2-ylbutanamide |
| SMILES | CC(CC1Oc2cc3sc(C(F)(F)CCC(=O)N(O)C(C)C)cc3c(F)c2O1)NO |
| InChI | InChI=1S/C19H23F3N2O5S/c1-9(2)24(27)15(25)4-5-19(21,22)14-7-11-13(30-14)8-12-18(17(11)20)29-16(28-12)6-10(3)23-26/h7-10,16,23,26-27H,4-6H2,1-3H3 |
| InChIKey | VVUDHQSICPPTCL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|