C13H27F2NOSi — CID 139050368
4,4-difluoro-N,N-di(propan-2-yl)-4-trimethylsilylbutanamide (PubChem CID 139050368) has the molecular formula C13H27F2NOSi and a molecular weight of 279.45 g/mol. Its IUPAC name is 4,4-difluoro-N,N-di(propan-2-yl)-4-trimethylsilylbutanamide.
| Compound Name | 4,4-difluoro-N,N-di(propan-2-yl)-4-trimethylsilylbutanamide |
|---|---|
| PubChem CID | 139050368 |
| Molecular Formula | C13H27F2NOSi |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4,4-difluoro-N,N-di(propan-2-yl)-4-trimethylsilylbutanamide |
| SMILES | CC(C)N(C(=O)CCC(F)(F)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C13H27F2NOSi/c1-10(2)16(11(3)4)12(17)8-9-13(14,15)18(5,6)7/h10-11H,8-9H2,1-7H3 |
| InChIKey | BGVCSVDCWCXHOJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|