C11H15BrN4O2S2 — CID 154981139
6-bromo-2-(dimethylaminosulfanyloxy)-8-ethylpyrido[2,3-d]pyrimidin-7-one;sulfane (PubChem CID 154981139) has the molecular formula C11H15BrN4O2S2 and a molecular weight of 379.31 g/mol. Its IUPAC name is 6-bromo-2-(dimethylaminosulfanyloxy)-8-ethylpyrido[2,3-d]pyrimidin-7-one;sulfane.
| Compound Name | 6-bromo-2-(dimethylaminosulfanyloxy)-8-ethylpyrido[2,3-d]pyrimidin-7-one;sulfane |
|---|---|
| PubChem CID | 154981139 |
| Molecular Formula | C11H15BrN4O2S2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 6-bromo-2-(dimethylaminosulfanyloxy)-8-ethylpyrido[2,3-d]pyrimidin-7-one;sulfane |
| SMILES | CCn1c(=O)c(Br)cc2cnc(OSN(C)C)nc21.S |
| InChI | InChI=1S/C11H13BrN4O2S.H2S/c1-4-16-9-7(5-8(12)10(16)17)6-13-11(14-9)18-19-15(2)3;/h5-6H,4H2,1-3H3;1H2 |
| InChIKey | ZCWPEVPGECPDPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|