C16H16N2O3 — CID 154981394
2-[[(3aS,6aS)-2-oxo-1,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]methyl]isoindole-1,3-dione (PubChem CID 154981394) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-2-oxo-1,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3aS,6aS)-2-oxo-1,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154981394 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[[(3aS,6aS)-2-oxo-1,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1C[C@]2(CN3C(=O)c4ccccc4C3=O)CCC[C@@H]2N1 |
| InChI | InChI=1S/C16H16N2O3/c19-13-8-16(7-3-6-12(16)17-13)9-18-14(20)10-4-1-2-5-11(10)15(18)21/h1-2,4-5,12H,3,6-9H2,(H,17,19)/t12-,16-/m0/s1 |
| InChIKey | FOKDMBZEECFJFJ-LRDDRELGSA-N |
| XLogP | 1.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|