C18H19NO3 — CID 11033817
2-[[(2S,5S)-2,5-bis(ethenyl)-1-hydroxycyclopentyl]methyl]isoindole-1,3-dione (PubChem CID 11033817) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[[(2S,5S)-2,5-bis(ethenyl)-1-hydroxycyclopentyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2S,5S)-2,5-bis(ethenyl)-1-hydroxycyclopentyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11033817 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[[(2S,5S)-2,5-bis(ethenyl)-1-hydroxycyclopentyl]methyl]isoindole-1,3-dione |
| SMILES | C=C[C@@H]1CC[C@@H](C=C)C1(O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO3/c1-3-12-9-10-13(4-2)18(12,22)11-19-16(20)14-7-5-6-8-15(14)17(19)21/h3-8,12-13,22H,1-2,9-11H2/t12-,13-/m1/s1 |
| InChIKey | CNOWDGLSXOIROI-CHWSQXEVSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|