C18H40O2Si2 — CID 15498298
(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(trimethylsilylmethyl)hex-5-en-3-ol (PubChem CID 15498298) has the molecular formula C18H40O2Si2 and a molecular weight of 344.69 g/mol. Its IUPAC name is (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(trimethylsilylmethyl)hex-5-en-3-ol.
| Compound Name | (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(trimethylsilylmethyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 15498298 |
| Molecular Formula | C18H40O2Si2 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(trimethylsilylmethyl)hex-5-en-3-ol |
| SMILES | CC(C)(C)C(O)C/C(=C/O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C18H40O2Si2/c1-17(2,3)16(19)12-15(14-21(7,8)9)13-20-22(10,11)18(4,5)6/h13,16,19H,12,14H2,1-11H3/b15-13- |
| InChIKey | YLEFPNKSAHVZFJ-SQFISAMPSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|