C20H45NO2Si3 — CID 10764358
N-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]formamide (PubChem CID 10764358) has the molecular formula C20H45NO2Si3 and a molecular weight of 415.84 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]formamide.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]formamide |
|---|---|
| PubChem CID | 10764358 |
| Molecular Formula | C20H45NO2Si3 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]formamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CC=C(C[Si](C)(C)C)C[Si](C)(C)C)NC=O |
| InChI | InChI=1S/C20H45NO2Si3/c1-20(2,3)26(10,11)23-14-19(21-17-22)13-12-18(15-24(4,5)6)16-25(7,8)9/h12,17,19H,13-16H2,1-11H3,(H,21,22) |
| InChIKey | SLWQIECXEBQWAH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|