C26H50ClNO4Si3 — CID 10721593
methyl (E)-5-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]imino-5-chloro-3-methyl-4-oxopent-2-enoate (PubChem CID 10721593) has the molecular formula C26H50ClNO4Si3 and a molecular weight of 560.40 g/mol. Its IUPAC name is methyl (E)-5-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]imino-5-chloro-3-methyl-4-oxopent-2-enoate.
| Compound Name | methyl (E)-5-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]imino-5-chloro-3-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 10721593 |
| Molecular Formula | C26H50ClNO4Si3 |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | methyl (E)-5-[1-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyl-5-(trimethylsilylmethyl)hex-4-en-2-yl]imino-5-chloro-3-methyl-4-oxopent-2-enoate |
| SMILES | COC(=O)/C=C(\C)C(=O)/C(Cl)=N/C(CC=C(C[Si](C)(C)C)C[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50ClNO4Si3/c1-20(16-23(29)31-5)24(30)25(27)28-22(17-32-35(12,13)26(2,3)4)15-14-21(18-33(6,7)8)19-34(9,10)11/h14,16,22H,15,17-19H2,1-13H3/b20-16+,28-25- |
| InChIKey | LJFCEVVFESJEGR-NAUBWAGKSA-N |
| XLogP | 7.70 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|