C19H26N2O2 — CID 154984566
2,3,4,5,6,7-hexamethylidenetridecanediamide (PubChem CID 154984566) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexamethylidenetridecanediamide.
| Compound Name | 2,3,4,5,6,7-hexamethylidenetridecanediamide |
|---|---|
| PubChem CID | 154984566 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2,3,4,5,6,7-hexamethylidenetridecanediamide |
| SMILES | C=C(CCCCCC(N)=O)C(=C)C(=C)C(=C)C(=C)C(=C)C(N)=O |
| InChI | InChI=1S/C19H26N2O2/c1-12(10-8-7-9-11-18(20)22)13(2)14(3)15(4)16(5)17(6)19(21)23/h1-11H2,(H2,20,22)(H2,21,23) |
| InChIKey | QJKGALOWUZHBHD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|