C29H48N8O9S — CID 154988276
2-[7-[2-[[4-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]phenyl]methylamino]-2-oxoethyl]-4-(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 154988276) has the molecular formula C29H48N8O9S and a molecular weight of 684.82 g/mol. Its IUPAC name is 2-[7-[2-[[4-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]phenyl]methylamino]-2-oxoethyl]-4-(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-[2-[[4-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]phenyl]methylamino]-2-oxoethyl]-4-(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 154988276 |
| Molecular Formula | C29H48N8O9S |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 2-[7-[2-[[4-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]phenyl]methylamino]-2-oxoethyl]-4-(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1ccc(CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(O)O)CC2)cc1)C(N)=O |
| InChI | InChI=1S/C29H48N8O9S/c1-47-15-6-23(28(30)45)33-29(46)32-22-4-2-21(3-5-22)16-31-24(38)17-34-7-9-35(18-25(39)40)11-13-37(20-27(43)44)14-12-36(10-8-34)19-26(41)42/h2-5,23,25,39-40H,6-20H2,1H3,(H2,30,45)(H,31,38)(H,41,42)(H,43,44)(H2,32,33,46)/t23-/m0/s1 |
| InChIKey | JGRCPKMFBKKLIN-QHCPKHFHSA-N |
| XLogP | -2.27 |
| TPSA | 241.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|