C15H17Br5O2 — CID 154991373
(2,3,4,5,6-pentabromophenyl)methyl 2,2,3,3-tetramethylbutanoate (PubChem CID 154991373) has the molecular formula C15H17Br5O2 and a molecular weight of 628.82 g/mol. Its IUPAC name is (2,3,4,5,6-pentabromophenyl)methyl 2,2,3,3-tetramethylbutanoate.
| Compound Name | (2,3,4,5,6-pentabromophenyl)methyl 2,2,3,3-tetramethylbutanoate |
|---|---|
| PubChem CID | 154991373 |
| Molecular Formula | C15H17Br5O2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 623.71 |
| IUPAC Name | (2,3,4,5,6-pentabromophenyl)methyl 2,2,3,3-tetramethylbutanoate |
| SMILES | CC(C)(C)C(C)(C)C(=O)OCc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C15H17Br5O2/c1-14(2,3)15(4,5)13(21)22-6-7-8(16)10(18)12(20)11(19)9(7)17/h6H2,1-5H3 |
| InChIKey | DMYMVMWZCFQWHO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|