C8H15O3- — CID 53446645
2,2,3,3-tetramethylbutaneperoxoate (PubChem CID 53446645) has the molecular formula C8H15O3- and a molecular weight of 159.20 g/mol. Its IUPAC name is 2,2,3,3-tetramethylbutaneperoxoate.
| Compound Name | 2,2,3,3-tetramethylbutaneperoxoate |
|---|---|
| PubChem CID | 53446645 |
| Molecular Formula | C8H15O3- |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2,2,3,3-tetramethylbutaneperoxoate |
| SMILES | CC(C)(C)C(C)(C)C(=O)O[O-] |
| InChI | InChI=1S/C8H16O3/c1-7(2,3)8(4,5)6(9)11-10/h10H,1-5H3/p-1 |
| InChIKey | VJJCQJYZFBGHNY-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|