C23H42O6 — CID 175379550
butanoyl 2,2,3,3-tetramethylbutanoate;butanoyl 2,2,3-trimethylbutanoate (PubChem CID 175379550) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is butanoyl 2,2,3,3-tetramethylbutanoate;butanoyl 2,2,3-trimethylbutanoate.
| Compound Name | butanoyl 2,2,3,3-tetramethylbutanoate;butanoyl 2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 175379550 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | butanoyl 2,2,3,3-tetramethylbutanoate;butanoyl 2,2,3-trimethylbutanoate |
| SMILES | CCCC(=O)OC(=O)C(C)(C)C(C)(C)C.CCCC(=O)OC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H22O3.C11H20O3/c1-7-8-9(13)15-10(14)12(5,6)11(2,3)4;1-6-7-9(12)14-10(13)11(4,5)8(2)3/h7-8H2,1-6H3;8H,6-7H2,1-5H3 |
| InChIKey | VIGPTKOWJJBLQO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|