C22H40O6 — CID 175418954
butanoyl 2,2,3-trimethylbutanoate;butanoyl 2,3,3-trimethylbutanoate (PubChem CID 175418954) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is butanoyl 2,2,3-trimethylbutanoate;butanoyl 2,3,3-trimethylbutanoate.
| Compound Name | butanoyl 2,2,3-trimethylbutanoate;butanoyl 2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 175418954 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | butanoyl 2,2,3-trimethylbutanoate;butanoyl 2,3,3-trimethylbutanoate |
| SMILES | CCCC(=O)OC(=O)C(C)(C)C(C)C.CCCC(=O)OC(=O)C(C)C(C)(C)C |
| InChI | InChI=1S/2C11H20O3/c1-6-7-9(12)14-10(13)8(2)11(3,4)5;1-6-7-9(12)14-10(13)11(4,5)8(2)3/h2*8H,6-7H2,1-5H3 |
| InChIKey | JQXXNWWQXPQCDW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|