C35H50F5N5O8 — CID 154995313
(2,3,4,5,6-pentafluorophenyl) 5-[[1-[3-(butanoylamino)propylamino]-1,7-dioxo-4-[3-oxo-3-[3-(propanoylamino)propylamino]propyl]octan-4-yl]amino]-5-oxopentanoate (PubChem CID 154995313) has the molecular formula C35H50F5N5O8 and a molecular weight of 763.80 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[[1-[3-(butanoylamino)propylamino]-1,7-dioxo-4-[3-oxo-3-[3-(propanoylamino)propylamino]propyl]octan-4-yl]amino]-5-oxopentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[[1-[3-(butanoylamino)propylamino]-1,7-dioxo-4-[3-oxo-3-[3-(propanoylamino)propylamino]propyl]octan-4-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 154995313 |
| Molecular Formula | C35H50F5N5O8 |
| Molecular Weight | 763.80 g/mol |
| Exact Mass | 763.36 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[[1-[3-(butanoylamino)propylamino]-1,7-dioxo-4-[3-oxo-3-[3-(propanoylamino)propylamino]propyl]octan-4-yl]amino]-5-oxopentanoate |
| SMILES | CCCC(=O)NCCCNC(=O)CCC(CCC(C)=O)(CCC(=O)NCCCNC(=O)CC)NC(=O)CCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H50F5N5O8/c1-4-9-24(48)42-19-8-21-44-26(50)14-17-35(15-12-22(3)46,16-13-25(49)43-20-7-18-41-23(47)5-2)45-27(51)10-6-11-28(52)53-34-32(39)30(37)29(36)31(38)33(34)40/h4-21H2,1-3H3,(H,41,47)(H,42,48)(H,43,49)(H,44,50)(H,45,51) |
| InChIKey | BQIFFXOTRKSMFV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|