C19H26O8 — CID 155001224
[2,3-diacetyloxy-3-(methoxymethyl)-4-phenylmethoxybutyl] acetate (PubChem CID 155001224) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is [2,3-diacetyloxy-3-(methoxymethyl)-4-phenylmethoxybutyl] acetate.
| Compound Name | [2,3-diacetyloxy-3-(methoxymethyl)-4-phenylmethoxybutyl] acetate |
|---|---|
| PubChem CID | 155001224 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2,3-diacetyloxy-3-(methoxymethyl)-4-phenylmethoxybutyl] acetate |
| SMILES | COCC(COCc1ccccc1)(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H26O8/c1-14(20)25-11-18(26-15(2)21)19(12-23-4,27-16(3)22)13-24-10-17-8-6-5-7-9-17/h5-9,18H,10-13H2,1-4H3 |
| InChIKey | BHWKHCWIAQJIHA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|