C15H25Cl2NO2 — CID 155002177
(5E,7E)-8-[2-chloroethyl(3-chloropropyl)amino]-5-methylnona-5,7-dienoic acid (PubChem CID 155002177) has the molecular formula C15H25Cl2NO2 and a molecular weight of 322.28 g/mol. Its IUPAC name is (5E,7E)-8-[2-chloroethyl(3-chloropropyl)amino]-5-methylnona-5,7-dienoic acid.
| Compound Name | (5E,7E)-8-[2-chloroethyl(3-chloropropyl)amino]-5-methylnona-5,7-dienoic acid |
|---|---|
| PubChem CID | 155002177 |
| Molecular Formula | C15H25Cl2NO2 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (5E,7E)-8-[2-chloroethyl(3-chloropropyl)amino]-5-methylnona-5,7-dienoic acid |
| SMILES | C/C(=C\C=C(/C)N(CCCl)CCCCl)CCCC(=O)O |
| InChI | InChI=1S/C15H25Cl2NO2/c1-13(5-3-6-15(19)20)7-8-14(2)18(12-10-17)11-4-9-16/h7-8H,3-6,9-12H2,1-2H3,(H,19,20)/b13-7+,14-8+ |
| InChIKey | IUOGHVPGQBNCQY-FNCQTZNRSA-N |
| XLogP | 4.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|