C33H34ClN3O5 — CID 155004214
2-[(3E,5Z)-6-chloro-3-(5,6-dimethoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-[[(1R)-1-cyclohexa-2,4-dien-1-ylbutyl]carbamoyl]benzoic acid (PubChem CID 155004214) has the molecular formula C33H34ClN3O5 and a molecular weight of 588.10 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-chloro-3-(5,6-dimethoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-[[(1R)-1-cyclohexa-2,4-dien-1-ylbutyl]carbamoyl]benzoic acid.
| Compound Name | 2-[(3E,5Z)-6-chloro-3-(5,6-dimethoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-[[(1R)-1-cyclohexa-2,4-dien-1-ylbutyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 155004214 |
| Molecular Formula | C33H34ClN3O5 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 2-[(3E,5Z)-6-chloro-3-(5,6-dimethoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-[[(1R)-1-cyclohexa-2,4-dien-1-ylbutyl]carbamoyl]benzoic acid |
| SMILES | C=C(/C(=C\C=C/Cl)c1nc2cc(OC)c(OC)cc2[nH]1)c1ccc(C(=O)N[C@H](CCC)C2C=CC=CC2)cc1C(=O)O |
| InChI | InChI=1S/C33H34ClN3O5/c1-5-10-26(21-11-7-6-8-12-21)37-32(38)22-14-15-23(25(17-22)33(39)40)20(2)24(13-9-16-34)31-35-27-18-29(41-3)30(42-4)19-28(27)36-31/h6-9,11,13-19,21,26H,2,5,10,12H2,1,3-4H3,(H,35,36)(H,37,38)(H,39,40)/b16-9-,24-13+/t21?,26-/m1/s1 |
| InChIKey | YXLOZFWVHLCJQQ-JRWUOTROSA-N |
| XLogP | 7.16 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|