C27H30ClFN4O4 — CID 155004013
2-[(2S)-2-chloro-6-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohex-3-en-1-yl]-5-[3-(dimethylamino)propylcarbamoyl]benzoic acid (PubChem CID 155004013) has the molecular formula C27H30ClFN4O4 and a molecular weight of 529.01 g/mol. Its IUPAC name is 2-[(2S)-2-chloro-6-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohex-3-en-1-yl]-5-[3-(dimethylamino)propylcarbamoyl]benzoic acid.
| Compound Name | 2-[(2S)-2-chloro-6-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohex-3-en-1-yl]-5-[3-(dimethylamino)propylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 155004013 |
| Molecular Formula | C27H30ClFN4O4 |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[(2S)-2-chloro-6-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohex-3-en-1-yl]-5-[3-(dimethylamino)propylcarbamoyl]benzoic acid |
| SMILES | COc1cc2nc(C3CC=C[C@H](Cl)C3c3ccc(C(=O)NCCCN(C)C)cc3C(=O)O)[nH]c2cc1F |
| InChI | InChI=1S/C27H30ClFN4O4/c1-33(2)11-5-10-30-26(34)15-8-9-16(18(12-15)27(35)36)24-17(6-4-7-19(24)28)25-31-21-13-20(29)23(37-3)14-22(21)32-25/h4,7-9,12-14,17,19,24H,5-6,10-11H2,1-3H3,(H,30,34)(H,31,32)(H,35,36)/t17?,19-,24?/m0/s1 |
| InChIKey | BXROJPPGGBGUSX-MZXKRHHESA-N |
| XLogP | 4.53 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|