C18H19N2O8S2- — CID 155007533
1-[[benzenesulfonyl(carboxymethyl)amino]methyl]-2-[[carboxymethyl(sulfinato)amino]methyl]benzene (PubChem CID 155007533) has the molecular formula C18H19N2O8S2- and a molecular weight of 455.49 g/mol. Its IUPAC name is 1-[[benzenesulfonyl(carboxymethyl)amino]methyl]-2-[[carboxymethyl(sulfinato)amino]methyl]benzene.
| Compound Name | 1-[[benzenesulfonyl(carboxymethyl)amino]methyl]-2-[[carboxymethyl(sulfinato)amino]methyl]benzene |
|---|---|
| PubChem CID | 155007533 |
| Molecular Formula | C18H19N2O8S2- |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-[[benzenesulfonyl(carboxymethyl)amino]methyl]-2-[[carboxymethyl(sulfinato)amino]methyl]benzene |
| SMILES | O=C(O)CN(Cc1ccccc1CN(CC(=O)O)S(=O)(=O)c1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C18H20N2O8S2/c21-17(22)12-19(29(25)26)10-14-6-4-5-7-15(14)11-20(13-18(23)24)30(27,28)16-8-2-1-3-9-16/h1-9H,10-13H2,(H,21,22)(H,23,24)(H,25,26)/p-1 |
| InChIKey | KPHLJHAXQIZXIA-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 155.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|