C23H23N3O — CID 155011627
(2S)-N-pyridin-2-yl-6-quinolin-4-ylspiro[2.5]octane-2-carboxamide (PubChem CID 155011627) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is (2S)-N-pyridin-2-yl-6-quinolin-4-ylspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-pyridin-2-yl-6-quinolin-4-ylspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 155011627 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (2S)-N-pyridin-2-yl-6-quinolin-4-ylspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)[C@H]1CC12CCC(c1ccnc3ccccc13)CC2 |
| InChI | InChI=1S/C23H23N3O/c27-22(26-21-7-3-4-13-25-21)19-15-23(19)11-8-16(9-12-23)17-10-14-24-20-6-2-1-5-18(17)20/h1-7,10,13-14,16,19H,8-9,11-12,15H2,(H,25,26,27)/t16?,19-,23?/m1/s1 |
| InChIKey | CMENBAYYEBQINL-VCDSYBKSSA-N |
| XLogP | 4.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |