C40H49N3O4 — CID 155017409
(2S)-N-(7-acetamido-9,9-dipentylfluoren-2-yl)-4-oxo-1-(4-phenylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 155017409) has the molecular formula C40H49N3O4 and a molecular weight of 635.85 g/mol. Its IUPAC name is (2S)-N-(7-acetamido-9,9-dipentylfluoren-2-yl)-4-oxo-1-(4-phenylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(7-acetamido-9,9-dipentylfluoren-2-yl)-4-oxo-1-(4-phenylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155017409 |
| Molecular Formula | C40H49N3O4 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.37 |
| IUPAC Name | (2S)-N-(7-acetamido-9,9-dipentylfluoren-2-yl)-4-oxo-1-(4-phenylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCC1(CCCCC)c2cc(NC(C)=O)ccc2-c2ccc(NC(=O)[C@@H]3CC(=O)CN3C(=O)CCCc3ccccc3)cc21 |
| InChI | InChI=1S/C40H49N3O4/c1-4-6-11-22-40(23-12-7-5-2)35-24-30(41-28(3)44)18-20-33(35)34-21-19-31(25-36(34)40)42-39(47)37-26-32(45)27-43(37)38(46)17-13-16-29-14-9-8-10-15-29/h8-10,14-15,18-21,24-25,37H,4-7,11-13,16-17,22-23,26-27H2,1-3H3,(H,41,44)(H,42,47)/t37-/m0/s1 |
| InChIKey | YKMQNXHLGFMGPZ-QNGWXLTQSA-N |
| XLogP | 8.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|