C9H13I2N — CID 155017525
(E)-1-cyclopropyl-N-ethyl-2,4-diiodobut-2-en-1-imine (PubChem CID 155017525) has the molecular formula C9H13I2N and a molecular weight of 389.02 g/mol. Its IUPAC name is (E)-1-cyclopropyl-N-ethyl-2,4-diiodobut-2-en-1-imine.
| Compound Name | (E)-1-cyclopropyl-N-ethyl-2,4-diiodobut-2-en-1-imine |
|---|---|
| PubChem CID | 155017525 |
| Molecular Formula | C9H13I2N |
| Molecular Weight | 389.02 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | (E)-1-cyclopropyl-N-ethyl-2,4-diiodobut-2-en-1-imine |
| SMILES | CC/N=C(C(/I)=C\CI)\C1CC1 |
| InChI | InChI=1S/C9H13I2N/c1-2-12-9(7-3-4-7)8(11)5-6-10/h5,7H,2-4,6H2,1H3/b8-5+,12-9+ |
| InChIKey | LGAOHUZZBSZJMC-LRELXJSQSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.02 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|