C10H17FN2O — CID 134221017
(1S,2S,4S)-4-(N-ethyl-C-methanimidoylcarbonimidoyl)-2-fluorocyclohexan-1-ol (PubChem CID 134221017) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is (1S,2S,4S)-4-(N-ethyl-C-methanimidoylcarbonimidoyl)-2-fluorocyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-4-(N-ethyl-C-methanimidoylcarbonimidoyl)-2-fluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 134221017 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (1S,2S,4S)-4-(N-ethyl-C-methanimidoylcarbonimidoyl)-2-fluorocyclohexan-1-ol |
| SMILES | [H]/N=C/C(=N\CC)[C@H]1CC[C@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C10H17FN2O/c1-2-13-9(6-12)7-3-4-10(14)8(11)5-7/h6-8,10,12,14H,2-5H2,1H3/b12-6+,13-9+/t7-,8-,10-/m0/s1 |
| InChIKey | LAQFVNFVJWTEPI-UGAFODOQSA-N |
| XLogP | 1.60 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|