C24H24N6O3 — CID 155017802
5-benzyl-N-[4-[6-(2-methoxyethoxy)-5-methyl-2-pyridinyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 155017802) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 5-benzyl-N-[4-[6-(2-methoxyethoxy)-5-methyl-2-pyridinyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[4-[6-(2-methoxyethoxy)-5-methyl-2-pyridinyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155017802 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 5-benzyl-N-[4-[6-(2-methoxyethoxy)-5-methyl-2-pyridinyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | COCCOc1nc(-c2ccnc(NC(=O)c3n[nH]c(Cc4ccccc4)n3)c2)ccc1C |
| InChI | InChI=1S/C24H24N6O3/c1-16-8-9-19(26-24(16)33-13-12-32-2)18-10-11-25-20(15-18)28-23(31)22-27-21(29-30-22)14-17-6-4-3-5-7-17/h3-11,15H,12-14H2,1-2H3,(H,25,28,31)(H,27,29,30) |
| InChIKey | QCUNVGULKCCWRV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|