C28H31N5O3 — CID 154658728
5-benzyl-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154658728) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-benzyl-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154658728 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 5-benzyl-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(OCCCC(C)(C)O)cc1-c1ccnc(NC(=O)c2n[nH]c(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C28H31N5O3/c1-19-10-11-22(36-15-7-13-28(2,3)35)18-23(19)21-12-14-29-24(17-21)31-27(34)26-30-25(32-33-26)16-20-8-5-4-6-9-20/h4-6,8-12,14,17-18,35H,7,13,15-16H2,1-3H3,(H,29,31,34)(H,30,32,33) |
| InChIKey | MMLBSGWUYVSYSY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|