C25H33N5O3 — CID 154658663
N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-5-(2-methylpropyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154658663) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-5-(2-methylpropyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-5-(2-methylpropyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154658663 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-5-(2-methylpropyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(OCCCC(C)(C)O)cc1-c1ccnc(NC(=O)c2n[nH]c(CC(C)C)n2)c1 |
| InChI | InChI=1S/C25H33N5O3/c1-16(2)13-22-27-23(30-29-22)24(31)28-21-14-18(9-11-26-21)20-15-19(8-7-17(20)3)33-12-6-10-25(4,5)32/h7-9,11,14-16,32H,6,10,12-13H2,1-5H3,(H,26,28,31)(H,27,29,30) |
| InChIKey | ZDOVYSBBINQQGP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|