C28H36ClN5O3 — CID 154659060
N-[4-[2-chloro-5-(4-ethyl-4-hydroxyhexoxy)phenyl]-2-pyridinyl]-5-(cyclopentylmethyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154659060) has the molecular formula C28H36ClN5O3 and a molecular weight of 526.08 g/mol. Its IUPAC name is N-[4-[2-chloro-5-(4-ethyl-4-hydroxyhexoxy)phenyl]-2-pyridinyl]-5-(cyclopentylmethyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[4-[2-chloro-5-(4-ethyl-4-hydroxyhexoxy)phenyl]-2-pyridinyl]-5-(cyclopentylmethyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154659060 |
| Molecular Formula | C28H36ClN5O3 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | N-[4-[2-chloro-5-(4-ethyl-4-hydroxyhexoxy)phenyl]-2-pyridinyl]-5-(cyclopentylmethyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCC(O)(CC)CCCOc1ccc(Cl)c(-c2ccnc(NC(=O)c3n[nH]c(CC4CCCC4)n3)c2)c1 |
| InChI | InChI=1S/C28H36ClN5O3/c1-3-28(36,4-2)13-7-15-37-21-10-11-23(29)22(18-21)20-12-14-30-24(17-20)32-27(35)26-31-25(33-34-26)16-19-8-5-6-9-19/h10-12,14,17-19,36H,3-9,13,15-16H2,1-2H3,(H,30,32,35)(H,31,33,34) |
| InChIKey | VYEXNXQYYLHHFW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|