C30H35N5O2 — CID 154658619
5-benzyl-N-[4-(2-methyl-5-octoxyphenyl)-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154658619) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 5-benzyl-N-[4-(2-methyl-5-octoxyphenyl)-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[4-(2-methyl-5-octoxyphenyl)-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154658619 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 5-benzyl-N-[4-(2-methyl-5-octoxyphenyl)-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCCCCCOc1ccc(C)c(-c2ccnc(NC(=O)c3n[nH]c(Cc4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C30H35N5O2/c1-3-4-5-6-7-11-18-37-25-15-14-22(2)26(21-25)24-16-17-31-27(20-24)33-30(36)29-32-28(34-35-29)19-23-12-9-8-10-13-23/h8-10,12-17,20-21H,3-7,11,18-19H2,1-2H3,(H,31,33,36)(H,32,34,35) |
| InChIKey | CVHJOZUXJPOPOZ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|