C27H29N5O3 — CID 154659059
5-benzyl-N-[4-[5-(5-hydroxypentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154659059) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-benzyl-N-[4-[5-(5-hydroxypentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[4-[5-(5-hydroxypentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154659059 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 5-benzyl-N-[4-[5-(5-hydroxypentoxy)-2-methylphenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(OCCCCCO)cc1-c1ccnc(NC(=O)c2n[nH]c(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H29N5O3/c1-19-10-11-22(35-15-7-3-6-14-33)18-23(19)21-12-13-28-24(17-21)30-27(34)26-29-25(31-32-26)16-20-8-4-2-5-9-20/h2,4-5,8-13,17-18,33H,3,6-7,14-16H2,1H3,(H,28,30,34)(H,29,31,32) |
| InChIKey | ABPDCIKRALHWCB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|