C28H28N6O3 — CID 154658679
5-benzyl-N-[4-[2-cyano-5-(4-hydroxy-4-methylpentoxy)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154658679) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 5-benzyl-N-[4-[2-cyano-5-(4-hydroxy-4-methylpentoxy)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[4-[2-cyano-5-(4-hydroxy-4-methylpentoxy)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154658679 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5-benzyl-N-[4-[2-cyano-5-(4-hydroxy-4-methylpentoxy)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)(O)CCCOc1ccc(C#N)c(-c2ccnc(NC(=O)c3n[nH]c(Cc4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C28H28N6O3/c1-28(2,36)12-6-14-37-22-10-9-21(18-29)23(17-22)20-11-13-30-24(16-20)32-27(35)26-31-25(33-34-26)15-19-7-4-3-5-8-19/h3-5,7-11,13,16-17,36H,6,12,14-15H2,1-2H3,(H,30,32,35)(H,31,33,34) |
| InChIKey | QCNZOIYICBLHMG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|