C12H13IO — CID 155023346
(1S)-8-iodo-1,2,3,5,6,7-hexahydro-s-indacen-1-ol (PubChem CID 155023346) has the molecular formula C12H13IO and a molecular weight of 300.14 g/mol. Its IUPAC name is (1S)-8-iodo-1,2,3,5,6,7-hexahydro-s-indacen-1-ol.
| Compound Name | (1S)-8-iodo-1,2,3,5,6,7-hexahydro-s-indacen-1-ol |
|---|---|
| PubChem CID | 155023346 |
| Molecular Formula | C12H13IO |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (1S)-8-iodo-1,2,3,5,6,7-hexahydro-s-indacen-1-ol |
| SMILES | O[C@H]1CCc2cc3c(c(I)c21)CCC3 |
| InChI | InChI=1S/C12H13IO/c13-12-9-3-1-2-7(9)6-8-4-5-10(14)11(8)12/h6,10,14H,1-5H2/t10-/m0/s1 |
| InChIKey | DJXRMZJNHBFELC-JTQLQIEISA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|