C10H16N2O4S — CID 155023973
[[carboxy(prop-2-enyl)amino]-methylsulfanylmethyl]-prop-2-enylcarbamic acid (PubChem CID 155023973) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is [[carboxy(prop-2-enyl)amino]-methylsulfanylmethyl]-prop-2-enylcarbamic acid.
| Compound Name | [[carboxy(prop-2-enyl)amino]-methylsulfanylmethyl]-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 155023973 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [[carboxy(prop-2-enyl)amino]-methylsulfanylmethyl]-prop-2-enylcarbamic acid |
| SMILES | C=CCN(C(=O)O)C(SC)N(CC=C)C(=O)O |
| InChI | InChI=1S/C10H16N2O4S/c1-4-6-11(9(13)14)8(17-3)12(7-5-2)10(15)16/h4-5,8H,1-2,6-7H2,3H3,(H,13,14)(H,15,16) |
| InChIKey | WFLJGIXMPYDMLZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|