C18H30O12P2S2+2 — CID 155026460
tris(2-carboxyethyl)-[tris(2-carboxyethyl)phosphaniumyldisulfanyl]phosphanium (PubChem CID 155026460) has the molecular formula C18H30O12P2S2+2 and a molecular weight of 564.51 g/mol. Its IUPAC name is tris(2-carboxyethyl)-[tris(2-carboxyethyl)phosphaniumyldisulfanyl]phosphanium.
| Compound Name | tris(2-carboxyethyl)-[tris(2-carboxyethyl)phosphaniumyldisulfanyl]phosphanium |
|---|---|
| PubChem CID | 155026460 |
| Molecular Formula | C18H30O12P2S2+2 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | tris(2-carboxyethyl)-[tris(2-carboxyethyl)phosphaniumyldisulfanyl]phosphanium |
| SMILES | O=C(O)CC[P+](CCC(=O)O)(CCC(=O)O)SS[P+](CCC(=O)O)(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C18H28O12P2S2/c19-13(20)1-7-31(8-2-14(21)22,9-3-15(23)24)33-34-32(10-4-16(25)26,11-5-17(27)28)12-6-18(29)30/h1-12H2,(H4-2,19,20,21,22,23,24,25,26,27,28,29,30)/p+2 |
| InChIKey | DVWDVRXVXKPGGA-UHFFFAOYSA-P |
| XLogP | 3.08 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|