C12H18O8S2 — CID 21330193
3-(1,4-dicarboxybutan-2-yldisulfanyl)hexanedioic acid (PubChem CID 21330193) has the molecular formula C12H18O8S2 and a molecular weight of 354.40 g/mol. Its IUPAC name is 3-(1,4-dicarboxybutan-2-yldisulfanyl)hexanedioic acid.
| Compound Name | 3-(1,4-dicarboxybutan-2-yldisulfanyl)hexanedioic acid |
|---|---|
| PubChem CID | 21330193 |
| Molecular Formula | C12H18O8S2 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-(1,4-dicarboxybutan-2-yldisulfanyl)hexanedioic acid |
| SMILES | O=C(O)CCC(CC(=O)O)SSC(CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H18O8S2/c13-9(14)3-1-7(5-11(17)18)21-22-8(6-12(19)20)2-4-10(15)16/h7-8H,1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | WCRUCQRLHWGRRB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|