C27H30N2O5 — CID 155033966
methyl 3-formyl-2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]-1H-indole-4-carboxylate (PubChem CID 155033966) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl 3-formyl-2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]-1H-indole-4-carboxylate.
| Compound Name | methyl 3-formyl-2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 155033966 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | methyl 3-formyl-2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(-c3ccc(C4CCCN(C(=O)OC(C)(C)C)C4)cc3)c(C=O)c12 |
| InChI | InChI=1S/C27H30N2O5/c1-27(2,3)34-26(32)29-14-6-7-19(15-29)17-10-12-18(13-11-17)24-21(16-30)23-20(25(31)33-4)8-5-9-22(23)28-24/h5,8-13,16,19,28H,6-7,14-15H2,1-4H3 |
| InChIKey | ZIJOJTJGLMQUBG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|