C26H32N4 — CID 155034298
5-ethenyl-N,4,5-trimethyl-2-(methylideneamino)-3-phenyl-N-propan-2-yl-3a,4-dihydroimidazo[1,2-a]quinolin-1-amine (PubChem CID 155034298) has the molecular formula C26H32N4 and a molecular weight of 400.57 g/mol. Its IUPAC name is 5-ethenyl-N,4,5-trimethyl-2-(methylideneamino)-3-phenyl-N-propan-2-yl-3a,4-dihydroimidazo[1,2-a]quinolin-1-amine.
| Compound Name | 5-ethenyl-N,4,5-trimethyl-2-(methylideneamino)-3-phenyl-N-propan-2-yl-3a,4-dihydroimidazo[1,2-a]quinolin-1-amine |
|---|---|
| PubChem CID | 155034298 |
| Molecular Formula | C26H32N4 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 5-ethenyl-N,4,5-trimethyl-2-(methylideneamino)-3-phenyl-N-propan-2-yl-3a,4-dihydroimidazo[1,2-a]quinolin-1-amine |
| SMILES | C=CC1(C)c2ccccc2N2C(N(C)C(C)C)=C(N=C)N(c3ccccc3)C2C1C |
| InChI | InChI=1S/C26H32N4/c1-8-26(5)19(4)24-29(20-14-10-9-11-15-20)23(27-6)25(28(7)18(2)3)30(24)22-17-13-12-16-21(22)26/h8-19,24H,1,6H2,2-5,7H3 |
| InChIKey | GPXZVPGAXCNDPP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|