C16H29N — CID 155036693
6-(2-methylpropylidene)-2-propan-2-yl-1,3,3a,4,5,7,8,8a-octahydrocyclohepta[c]pyrrole (PubChem CID 155036693) has the molecular formula C16H29N and a molecular weight of 235.42 g/mol. Its IUPAC name is 6-(2-methylpropylidene)-2-propan-2-yl-1,3,3a,4,5,7,8,8a-octahydrocyclohepta[c]pyrrole.
| Compound Name | 6-(2-methylpropylidene)-2-propan-2-yl-1,3,3a,4,5,7,8,8a-octahydrocyclohepta[c]pyrrole |
|---|---|
| PubChem CID | 155036693 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 6-(2-methylpropylidene)-2-propan-2-yl-1,3,3a,4,5,7,8,8a-octahydrocyclohepta[c]pyrrole |
| SMILES | CC(C)C=C1CCC2CN(C(C)C)CC2CC1 |
| InChI | InChI=1S/C16H29N/c1-12(2)9-14-5-7-15-10-17(13(3)4)11-16(15)8-6-14/h9,12-13,15-16H,5-8,10-11H2,1-4H3 |
| InChIKey | UHTOAFFISJEXFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|