C9H21N3 — CID 155040409
(2S,5R)-2,5-dimethyl-4-propan-2-ylpiperazin-1-amine (PubChem CID 155040409) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-4-propan-2-ylpiperazin-1-amine.
| Compound Name | (2S,5R)-2,5-dimethyl-4-propan-2-ylpiperazin-1-amine |
|---|---|
| PubChem CID | 155040409 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-4-propan-2-ylpiperazin-1-amine |
| SMILES | CC(C)N1C[C@H](C)N(N)C[C@H]1C |
| InChI | InChI=1S/C9H21N3/c1-7(2)11-5-9(4)12(10)6-8(11)3/h7-9H,5-6,10H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | JOFNPBFRGWTCTA-BDAKNGLRSA-N |
| XLogP | 0.66 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|