C37H46N6O — CID 155041731
4-[3-[2-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]-8,12,20-triazapentacyclo[11.7.1.02,7.08,21.014,19]henicosa-1(20),4,6,13(21),14,16,18-heptaen-12-yl]propyl]morpholine (PubChem CID 155041731) has the molecular formula C37H46N6O and a molecular weight of 590.82 g/mol. Its IUPAC name is 4-[3-[2-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]-8,12,20-triazapentacyclo[11.7.1.02,7.08,21.014,19]henicosa-1(20),4,6,13(21),14,16,18-heptaen-12-yl]propyl]morpholine.
| Compound Name | 4-[3-[2-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]-8,12,20-triazapentacyclo[11.7.1.02,7.08,21.014,19]henicosa-1(20),4,6,13(21),14,16,18-heptaen-12-yl]propyl]morpholine |
|---|---|
| PubChem CID | 155041731 |
| Molecular Formula | C37H46N6O |
| Molecular Weight | 590.82 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | 4-[3-[2-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]-8,12,20-triazapentacyclo[11.7.1.02,7.08,21.014,19]henicosa-1(20),4,6,13(21),14,16,18-heptaen-12-yl]propyl]morpholine |
| SMILES | CN1CCN(c2ccc(C3=CC=C4N5CCCN(CCCN6CCOCC6)c6c5c(nc5ccccc65)C4(C)C3)cc2)CC1 |
| InChI | InChI=1S/C37H46N6O/c1-37-27-29(28-9-12-30(13-10-28)41-21-19-39(2)20-22-41)11-14-33(37)43-18-6-17-42(16-5-15-40-23-25-44-26-24-40)34-31-7-3-4-8-32(31)38-36(37)35(34)43/h3-4,7-14H,5-6,15-27H2,1-2H3 |
| InChIKey | YBZJOBNVTYNABG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.82 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|