C18H24N4O5 — CID 155045239
[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-(2,5-dioxopyrrolidin-1-yl)carbamic acid (PubChem CID 155045239) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is [4-[2-(diethylamino)ethylcarbamoyl]phenyl]-(2,5-dioxopyrrolidin-1-yl)carbamic acid.
| Compound Name | [4-[2-(diethylamino)ethylcarbamoyl]phenyl]-(2,5-dioxopyrrolidin-1-yl)carbamic acid |
|---|---|
| PubChem CID | 155045239 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [4-[2-(diethylamino)ethylcarbamoyl]phenyl]-(2,5-dioxopyrrolidin-1-yl)carbamic acid |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N(C(=O)O)N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C18H24N4O5/c1-3-20(4-2)12-11-19-17(25)13-5-7-14(8-6-13)21(18(26)27)22-15(23)9-10-16(22)24/h5-8H,3-4,9-12H2,1-2H3,(H,19,25)(H,26,27) |
| InChIKey | JZHVQEMFZUDJHD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|