C25H32N6O6 — CID 155047637
[6-[1-(2-cyano-1-cyclopentylethenyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid (PubChem CID 155047637) has the molecular formula C25H32N6O6 and a molecular weight of 512.57 g/mol. Its IUPAC name is [6-[1-(2-cyano-1-cyclopentylethenyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid.
| Compound Name | [6-[1-(2-cyano-1-cyclopentylethenyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
|---|---|
| PubChem CID | 155047637 |
| Molecular Formula | C25H32N6O6 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [6-[1-(2-cyano-1-cyclopentylethenyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
| SMILES | COC(Cc1c(-c2cnn(C(=CC#N)C3CCCC3)c2)ncnc1N(C(=O)O)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C25H32N6O6/c1-25(2,3)37-24(34)31(23(32)33)22-18(12-20(35-4)36-5)21(27-15-28-22)17-13-29-30(14-17)19(10-11-26)16-8-6-7-9-16/h10,13-16,20H,6-9,12H2,1-5H3,(H,32,33) |
| InChIKey | WVVOCEOPNIEIKU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|