C21H42INO10 — CID 155047976
4-[2-[2-[2-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butylcarbamic acid (PubChem CID 155047976) has the molecular formula C21H42INO10 and a molecular weight of 595.47 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butylcarbamic acid.
| Compound Name | 4-[2-[2-[2-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butylcarbamic acid |
|---|---|
| PubChem CID | 155047976 |
| Molecular Formula | C21H42INO10 |
| Molecular Weight | 595.47 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 4-[2-[2-[2-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butylcarbamic acid |
| SMILES | O=C(O)NCCCCOCCOCCOCCOCCOCCOCCOCCOCCI |
| InChI | InChI=1S/C21H42INO10/c22-3-6-27-8-10-29-12-14-31-16-18-33-20-19-32-17-15-30-13-11-28-9-7-26-5-2-1-4-23-21(24)25/h23H,1-20H2,(H,24,25) |
| InChIKey | PAKCOJQXGXLCMT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|