About 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane
3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane (PubChem CID 155048511) has the molecular formula C9H17F3S2
and a molecular weight of 246.36 g/mol. Its IUPAC name is 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane.
Molecular Properties
| Compound Name | 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane |
| PubChem CID | 155048511 |
| Molecular Formula | C9H17F3S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane |
| SMILES | CCC(CC(F)(F)F)SSC(C)(C)C |
| InChI | InChI=1S/C9H17F3S2/c1-5-7(6-9(10,11)12)13-14-8(2,3)4/h7H,5-6H2,1-4H3 |
| InChIKey | VBMKSVYOHXIQQC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane?
The IUPAC name of 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane (CID 155048511) is 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane.
What is the SMILES notation for 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane?
The canonical SMILES for 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane is CCC(CC(F)(F)F)SSC(C)(C)C.
What is the InChIKey of 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane?
The InChIKey is VBMKSVYOHXIQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3S2/c1-5-7(6-9(10,11)12)13-14-8(2,3)4/h7H,5-6H2,1-4H3.
What are the key properties of 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane?
3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane has a molecular weight of 246.36 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tert-butyldisulfanyl)-1,1,1-trifluoropentane is sourced from PubChem (CID 155048511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).