C10H19Cl3S2 — CID 155048538
2-(tert-butyldisulfanyl)-1,1,1-trichloro-3-methylpentane (PubChem CID 155048538) has the molecular formula C10H19Cl3S2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-(tert-butyldisulfanyl)-1,1,1-trichloro-3-methylpentane.
| Compound Name | 2-(tert-butyldisulfanyl)-1,1,1-trichloro-3-methylpentane |
|---|---|
| PubChem CID | 155048538 |
| Molecular Formula | C10H19Cl3S2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-(tert-butyldisulfanyl)-1,1,1-trichloro-3-methylpentane |
| SMILES | CCC(C)C(SSC(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H19Cl3S2/c1-6-7(2)8(10(11,12)13)14-15-9(3,4)5/h7-8H,6H2,1-5H3 |
| InChIKey | KFBZOHAVKAHXJH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|