C8H15Cl3S2 — CID 154990276
(2R)-1,1,1-trichloro-3-methyl-2-(propan-2-yldisulfanyl)butane (PubChem CID 154990276) has the molecular formula C8H15Cl3S2 and a molecular weight of 281.70 g/mol. Its IUPAC name is (2R)-1,1,1-trichloro-3-methyl-2-(propan-2-yldisulfanyl)butane.
| Compound Name | (2R)-1,1,1-trichloro-3-methyl-2-(propan-2-yldisulfanyl)butane |
|---|---|
| PubChem CID | 154990276 |
| Molecular Formula | C8H15Cl3S2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | (2R)-1,1,1-trichloro-3-methyl-2-(propan-2-yldisulfanyl)butane |
| SMILES | CC(C)SS[C@H](C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H15Cl3S2/c1-5(2)7(8(9,10)11)13-12-6(3)4/h5-7H,1-4H3/t7-/m1/s1 |
| InChIKey | UPALSESZNPOKLH-SSDOTTSWSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|