C8H7BrN3O3S2+ — CID 155053835
[4-(3-bromo-1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid (PubChem CID 155053835) has the molecular formula C8H7BrN3O3S2+ and a molecular weight of 337.20 g/mol. Its IUPAC name is [4-(3-bromo-1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid.
| Compound Name | [4-(3-bromo-1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 155053835 |
| Molecular Formula | C8H7BrN3O3S2+ |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | [4-(3-bromo-1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)C[n+]1ccc(-c2nc(Br)ns2)cc1 |
| InChI | InChI=1S/C8H6BrN3O3S2/c9-8-10-7(16-11-8)6-1-3-12(4-2-6)5-17(13,14)15/h1-4H,5H2/p+1 |
| InChIKey | IEGTWTFCOZPNLW-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|