C4H13NO6P2 — CID 155056591
(1-dihydroxyphosphinimyl-1-methoxypropyl)phosphonic acid (PubChem CID 155056591) has the molecular formula C4H13NO6P2 and a molecular weight of 233.10 g/mol. Its IUPAC name is (1-dihydroxyphosphinimyl-1-methoxypropyl)phosphonic acid.
| Compound Name | (1-dihydroxyphosphinimyl-1-methoxypropyl)phosphonic acid |
|---|---|
| PubChem CID | 155056591 |
| Molecular Formula | C4H13NO6P2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | (1-dihydroxyphosphinimyl-1-methoxypropyl)phosphonic acid |
| SMILES | [H]N=P(O)(O)C(CC)(OC)P(=O)(O)O |
| InChI | InChI=1S/C4H13NO6P2/c1-3-4(11-2,12(5,6)7)13(8,9)10/h3H2,1-2H3,(H3,5,6,7)(H2,8,9,10) |
| InChIKey | TUHSCQLCVAICQW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|